C22H25F3N4O3S — CID 31418020
N-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl]-4-(trifluoromethoxy)aniline (PubChem CID 31418020) has the molecular formula C22H25F3N4O3S and a molecular weight of 482.53 g/mol. Its IUPAC name is N-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 31418020 |
| Molecular Formula | C22H25F3N4O3S |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | N-[(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)methyl]-4-(trifluoromethoxy)aniline |
| SMILES | CCn1c(CNc2ccc(OC(F)(F)F)cc2)nc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C22H25F3N4O3S/c1-2-29-20-11-10-18(33(30,31)28-12-4-3-5-13-28)14-19(20)27-21(29)15-26-16-6-8-17(9-7-16)32-22(23,24)25/h6-11,14,26H,2-5,12-13,15H2,1H3 |
| InChIKey | JABCENNNDMYVHJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|