C25H23N5O3 — CID 46633272
N-[4-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]carbamoyl]phenyl]benzamide (PubChem CID 46633272) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is N-[4-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]carbamoyl]phenyl]benzamide.
| Compound Name | N-[4-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46633272 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N-[4-[[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]carbamoyl]phenyl]benzamide |
| SMILES | CCn1c(C)nc2cc(C(=O)NNC(=O)c3ccc(NC(=O)c4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C25H23N5O3/c1-3-30-16(2)26-21-15-19(11-14-22(21)30)25(33)29-28-24(32)18-9-12-20(13-10-18)27-23(31)17-7-5-4-6-8-17/h4-15H,3H2,1-2H3,(H,27,31)(H,28,32)(H,29,33) |
| InChIKey | FBNSKICDJJPPNT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|