C21H24N4O2 — CID 2090701
1-ethyl-2-methyl-N'-[(3S)-3-phenylbutanoyl]benzimidazole-5-carbohydrazide (PubChem CID 2090701) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-ethyl-2-methyl-N'-[(3S)-3-phenylbutanoyl]benzimidazole-5-carbohydrazide.
| Compound Name | 1-ethyl-2-methyl-N'-[(3S)-3-phenylbutanoyl]benzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2090701 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-ethyl-2-methyl-N'-[(3S)-3-phenylbutanoyl]benzimidazole-5-carbohydrazide |
| SMILES | CCn1c(C)nc2cc(C(=O)NNC(=O)C[C@H](C)c3ccccc3)ccc21 |
| InChI | InChI=1S/C21H24N4O2/c1-4-25-15(3)22-18-13-17(10-11-19(18)25)21(27)24-23-20(26)12-14(2)16-8-6-5-7-9-16/h5-11,13-14H,4,12H2,1-3H3,(H,23,26)(H,24,27)/t14-/m0/s1 |
| InChIKey | IYDBCOWVOVHATJ-AWEZNQCLSA-N |
| XLogP | 3.32 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|