C20H19F3N4O2 — CID 24534673
1-ethyl-2-methyl-N'-[2-[4-(trifluoromethyl)phenyl]acetyl]benzimidazole-5-carbohydrazide (PubChem CID 24534673) has the molecular formula C20H19F3N4O2 and a molecular weight of 404.39 g/mol. Its IUPAC name is 1-ethyl-2-methyl-N'-[2-[4-(trifluoromethyl)phenyl]acetyl]benzimidazole-5-carbohydrazide.
| Compound Name | 1-ethyl-2-methyl-N'-[2-[4-(trifluoromethyl)phenyl]acetyl]benzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24534673 |
| Molecular Formula | C20H19F3N4O2 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1-ethyl-2-methyl-N'-[2-[4-(trifluoromethyl)phenyl]acetyl]benzimidazole-5-carbohydrazide |
| SMILES | CCn1c(C)nc2cc(C(=O)NNC(=O)Cc3ccc(C(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C20H19F3N4O2/c1-3-27-12(2)24-16-11-14(6-9-17(16)27)19(29)26-25-18(28)10-13-4-7-15(8-5-13)20(21,22)23/h4-9,11H,3,10H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | QPWQFNDUONIBMR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|