C19H17ClF3N5OS — CID 2324821
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]thiourea (PubChem CID 2324821) has the molecular formula C19H17ClF3N5OS and a molecular weight of 455.89 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]thiourea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 2324821 |
| Molecular Formula | C19H17ClF3N5OS |
| Molecular Weight | 455.89 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(1-ethyl-2-methylbenzimidazole-5-carbonyl)amino]thiourea |
| SMILES | CCn1c(C)nc2cc(C(=O)NNC(=S)Nc3cc(C(F)(F)F)ccc3Cl)ccc21 |
| InChI | InChI=1S/C19H17ClF3N5OS/c1-3-28-10(2)24-15-8-11(4-7-16(15)28)17(29)26-27-18(30)25-14-9-12(19(21,22)23)5-6-13(14)20/h4-9H,3H2,1-2H3,(H,26,29)(H2,25,27,30) |
| InChIKey | FVHNXZDMTOTFPE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.89 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|