C18H19N5O4 — CID 27166329
N-[2-[2-(1-ethyl-2-methylbenzimidazole-5-carbonyl)hydrazinyl]-2-oxoethyl]furan-2-carboxamide (PubChem CID 27166329) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is N-[2-[2-(1-ethyl-2-methylbenzimidazole-5-carbonyl)hydrazinyl]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[2-(1-ethyl-2-methylbenzimidazole-5-carbonyl)hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 27166329 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-[2-[2-(1-ethyl-2-methylbenzimidazole-5-carbonyl)hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
| SMILES | CCn1c(C)nc2cc(C(=O)NNC(=O)CNC(=O)c3ccco3)ccc21 |
| InChI | InChI=1S/C18H19N5O4/c1-3-23-11(2)20-13-9-12(6-7-14(13)23)17(25)22-21-16(24)10-19-18(26)15-5-4-8-27-15/h4-9H,3,10H2,1-2H3,(H,19,26)(H,21,24)(H,22,25) |
| InChIKey | WPJNICFLCSZSOW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 118.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|