C17H18N4OS — CID 2397383
1-ethyl-2-methyl-N'-(1-thiophen-2-ylethenyl)benzimidazole-5-carbohydrazide (PubChem CID 2397383) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is 1-ethyl-2-methyl-N'-(1-thiophen-2-ylethenyl)benzimidazole-5-carbohydrazide.
| Compound Name | 1-ethyl-2-methyl-N'-(1-thiophen-2-ylethenyl)benzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2397383 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-ethyl-2-methyl-N'-(1-thiophen-2-ylethenyl)benzimidazole-5-carbohydrazide |
| SMILES | C=C(NNC(=O)c1ccc2c(c1)nc(C)n2CC)c1cccs1 |
| InChI | InChI=1S/C17H18N4OS/c1-4-21-12(3)18-14-10-13(7-8-15(14)21)17(22)20-19-11(2)16-6-5-9-23-16/h5-10,19H,2,4H2,1,3H3,(H,20,22) |
| InChIKey | NXCHTNPSTCEQRC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|