C18H16N2O7S — CID 30766313
2-[6-[(2-acetylphenyl)sulfamoyl]-3-oxo-1,4-benzoxazin-4-yl]acetic acid (PubChem CID 30766313) has the molecular formula C18H16N2O7S and a molecular weight of 404.40 g/mol. Its IUPAC name is 2-[6-[(2-acetylphenyl)sulfamoyl]-3-oxo-1,4-benzoxazin-4-yl]acetic acid.
| Compound Name | 2-[6-[(2-acetylphenyl)sulfamoyl]-3-oxo-1,4-benzoxazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 30766313 |
| Molecular Formula | C18H16N2O7S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-[6-[(2-acetylphenyl)sulfamoyl]-3-oxo-1,4-benzoxazin-4-yl]acetic acid |
| SMILES | CC(=O)c1ccccc1NS(=O)(=O)c1ccc2c(c1)N(CC(=O)O)C(=O)CO2 |
| InChI | InChI=1S/C18H16N2O7S/c1-11(21)13-4-2-3-5-14(13)19-28(25,26)12-6-7-16-15(8-12)20(9-18(23)24)17(22)10-27-16/h2-8,19H,9-10H2,1H3,(H,23,24) |
| InChIKey | SDYKLJQDEULTLD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |