C23H27N3O5S — CID 20914115
2-[6-(cyclopentylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 20914115) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is 2-[6-(cyclopentylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[6-(cyclopentylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 20914115 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 2-[6-(cyclopentylsulfamoyl)-3-oxo-1,4-benzoxazin-4-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1C(=O)COc2ccc(S(=O)(=O)NC3CCCC3)cc21 |
| InChI | InChI=1S/C23H27N3O5S/c1-2-16-7-3-6-10-19(16)24-22(27)14-26-20-13-18(11-12-21(20)31-15-23(26)28)32(29,30)25-17-8-4-5-9-17/h3,6-7,10-13,17,25H,2,4-5,8-9,14-15H2,1H3,(H,24,27) |
| InChIKey | FEHMVTAUZIOVAW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |