C16H15NO4S — CID 46807428
N-(2-acetylphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide (PubChem CID 46807428) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide.
| Compound Name | N-(2-acetylphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 46807428 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-(2-acetylphenyl)-2,3-dihydro-1-benzofuran-5-sulfonamide |
| SMILES | CC(=O)c1ccccc1NS(=O)(=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H15NO4S/c1-11(18)14-4-2-3-5-15(14)17-22(19,20)13-6-7-16-12(10-13)8-9-21-16/h2-7,10,17H,8-9H2,1H3 |
| InChIKey | OSAUQQHZGPSBFL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |