C23H21NO5S — CID 158681936
4-phenyl-2-(2,3,4,5-tetrahydro-1-benzoxepin-7-ylsulfonylamino)benzoic acid (PubChem CID 158681936) has the molecular formula C23H21NO5S and a molecular weight of 423.49 g/mol. Its IUPAC name is 4-phenyl-2-(2,3,4,5-tetrahydro-1-benzoxepin-7-ylsulfonylamino)benzoic acid.
| Compound Name | 4-phenyl-2-(2,3,4,5-tetrahydro-1-benzoxepin-7-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 158681936 |
| Molecular Formula | C23H21NO5S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 4-phenyl-2-(2,3,4,5-tetrahydro-1-benzoxepin-7-ylsulfonylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2)cc1NS(=O)(=O)c1ccc2c(c1)CCCCO2 |
| InChI | InChI=1S/C23H21NO5S/c25-23(26)20-11-9-17(16-6-2-1-3-7-16)15-21(20)24-30(27,28)19-10-12-22-18(14-19)8-4-5-13-29-22/h1-3,6-7,9-12,14-15,24H,4-5,8,13H2,(H,25,26) |
| InChIKey | SRMYJJTYYHAJKY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |