C9H10O4S — CID 22471808
3,4-dihydro-2H-chromene-6-sulfonic acid (PubChem CID 22471808) has the molecular formula C9H10O4S and a molecular weight of 214.24 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromene-6-sulfonic acid.
| Compound Name | 3,4-dihydro-2H-chromene-6-sulfonic acid |
|---|---|
| PubChem CID | 22471808 |
| Molecular Formula | C9H10O4S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 3,4-dihydro-2H-chromene-6-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C9H10O4S/c10-14(11,12)8-3-4-9-7(6-8)2-1-5-13-9/h3-4,6H,1-2,5H2,(H,10,11,12) |
| InChIKey | ZCDMGFHZKGALMR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|