C21H24N2O6S2 — CID 55511916
1,4-bis(2,3-dihydro-1-benzofuran-5-ylsulfonyl)-1,4-diazepane (PubChem CID 55511916) has the molecular formula C21H24N2O6S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 1,4-bis(2,3-dihydro-1-benzofuran-5-ylsulfonyl)-1,4-diazepane.
| Compound Name | 1,4-bis(2,3-dihydro-1-benzofuran-5-ylsulfonyl)-1,4-diazepane |
|---|---|
| PubChem CID | 55511916 |
| Molecular Formula | C21H24N2O6S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 1,4-bis(2,3-dihydro-1-benzofuran-5-ylsulfonyl)-1,4-diazepane |
| SMILES | O=S(=O)(c1ccc2c(c1)CCO2)N1CCCN(S(=O)(=O)c2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C21H24N2O6S2/c24-30(25,18-2-4-20-16(14-18)6-12-28-20)22-8-1-9-23(11-10-22)31(26,27)19-3-5-21-17(15-19)7-13-29-21/h2-5,14-15H,1,6-13H2 |
| InChIKey | WQBUEGBPZLSIHX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |