C15H22N2O5S2 — CID 110819027
1-(3,4-dihydro-2H-chromen-6-ylsulfonyl)-4-ethylsulfonylpiperazine (PubChem CID 110819027) has the molecular formula C15H22N2O5S2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-6-ylsulfonyl)-4-ethylsulfonylpiperazine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-6-ylsulfonyl)-4-ethylsulfonylpiperazine |
|---|---|
| PubChem CID | 110819027 |
| Molecular Formula | C15H22N2O5S2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-6-ylsulfonyl)-4-ethylsulfonylpiperazine |
| SMILES | CCS(=O)(=O)N1CCN(S(=O)(=O)c2ccc3c(c2)CCCO3)CC1 |
| InChI | InChI=1S/C15H22N2O5S2/c1-2-23(18,19)16-7-9-17(10-8-16)24(20,21)14-5-6-15-13(12-14)4-3-11-22-15/h5-6,12H,2-4,7-11H2,1H3 |
| InChIKey | WBQCWOXEFDWUSU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |