C13H18N2O3S — CID 43556396
1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperidin-4-amine (PubChem CID 43556396) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperidin-4-amine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperidin-4-amine |
|---|---|
| PubChem CID | 43556396 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperidin-4-amine |
| SMILES | NC1CCN(S(=O)(=O)c2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C13H18N2O3S/c14-11-3-6-15(7-4-11)19(16,17)12-1-2-13-10(9-12)5-8-18-13/h1-2,9,11H,3-8,14H2 |
| InChIKey | OAIXGWBZUWOUCF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |