C12H15NO4S — CID 66291738
(3R)-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)pyrrolidin-3-ol (PubChem CID 66291738) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is (3R)-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)pyrrolidin-3-ol.
| Compound Name | (3R)-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 66291738 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | (3R)-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)pyrrolidin-3-ol |
| SMILES | O=S(=O)(c1ccc2c(c1)CCO2)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C12H15NO4S/c14-10-3-5-13(8-10)18(15,16)11-1-2-12-9(7-11)4-6-17-12/h1-2,7,10,14H,3-6,8H2/t10-/m1/s1 |
| InChIKey | BRTHKLSCUAANML-SNVBAGLBSA-N |
| XLogP | 0.38 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |