C13H15NO4S — CID 162360978
(3R)-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)pyrrolidine-3-carbaldehyde (PubChem CID 162360978) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is (3R)-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)pyrrolidine-3-carbaldehyde.
| Compound Name | (3R)-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)pyrrolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 162360978 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (3R)-1-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)pyrrolidine-3-carbaldehyde |
| SMILES | O=C[C@@H]1CCN(S(=O)(=O)c2ccc3c(c2)CCO3)C1 |
| InChI | InChI=1S/C13H15NO4S/c15-9-10-3-5-14(8-10)19(16,17)12-1-2-13-11(7-12)4-6-18-13/h1-2,7,9-10H,3-6,8H2/t10-/m1/s1 |
| InChIKey | KKKBZEQBPZVXRI-SNVBAGLBSA-N |
| XLogP | 0.83 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|