C14H19NO5S — CID 43394271
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)piperidin-3-ol (PubChem CID 43394271) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)piperidin-3-ol.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)piperidin-3-ol |
|---|---|
| PubChem CID | 43394271 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)piperidin-3-ol |
| SMILES | O=S(=O)(c1ccc2c(c1)OCCCO2)N1CCCC(O)C1 |
| InChI | InChI=1S/C14H19NO5S/c16-11-3-1-6-15(10-11)21(17,18)12-4-5-13-14(9-12)20-8-2-7-19-13/h4-5,9,11,16H,1-3,6-8,10H2 |
| InChIKey | GIBOHBXBFPLXOD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |