C13H16N2O5S — CID 107225159
6-[(3S)-3-hydroxypiperidin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 107225159) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 6-[(3S)-3-hydroxypiperidin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(3S)-3-hydroxypiperidin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 107225159 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 6-[(3S)-3-hydroxypiperidin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(S(=O)(=O)N3CCC[C@H](O)C3)cc2N1 |
| InChI | InChI=1S/C13H16N2O5S/c16-9-2-1-5-15(7-9)21(18,19)10-3-4-12-11(6-10)14-13(17)8-20-12/h3-4,6,9,16H,1-2,5,7-8H2,(H,14,17)/t9-/m0/s1 |
| InChIKey | ZPSPQEHQJRRRAF-VIFPVBQESA-N |
| XLogP | 0.16 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |