C14H18N2O4S — CID 22548236
6-(azepan-1-ylsulfonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 22548236) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 6-(azepan-1-ylsulfonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(azepan-1-ylsulfonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 22548236 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 6-(azepan-1-ylsulfonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(S(=O)(=O)N3CCCCCC3)cc2N1 |
| InChI | InChI=1S/C14H18N2O4S/c17-14-10-20-13-6-5-11(9-12(13)15-14)21(18,19)16-7-3-1-2-4-8-16/h5-6,9H,1-4,7-8,10H2,(H,15,17) |
| InChIKey | BLWAUCYSTREVNA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |