C16H20N2O6S — CID 22548275
ethyl 1-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]piperidine-3-carboxylate (PubChem CID 22548275) has the molecular formula C16H20N2O6S and a molecular weight of 368.41 g/mol. Its IUPAC name is ethyl 1-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 22548275 |
| Molecular Formula | C16H20N2O6S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | ethyl 1-[(3-oxo-4H-1,4-benzoxazin-6-yl)sulfonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(S(=O)(=O)c2ccc3c(c2)NC(=O)CO3)C1 |
| InChI | InChI=1S/C16H20N2O6S/c1-2-23-16(20)11-4-3-7-18(9-11)25(21,22)12-5-6-14-13(8-12)17-15(19)10-24-14/h5-6,8,11H,2-4,7,9-10H2,1H3,(H,17,19) |
| InChIKey | ODDKJDLWEQZTTA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |