C14H19N3O4S — CID 22548280
6-(4-ethylpiperazin-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 22548280) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is 6-(4-ethylpiperazin-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(4-ethylpiperazin-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 22548280 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 6-(4-ethylpiperazin-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | CCN1CCN(S(=O)(=O)c2ccc3c(c2)NC(=O)CO3)CC1 |
| InChI | InChI=1S/C14H19N3O4S/c1-2-16-5-7-17(8-6-16)22(19,20)11-3-4-13-12(9-11)15-14(18)10-21-13/h3-4,9H,2,5-8,10H2,1H3,(H,15,18) |
| InChIKey | QHSFSRVIDGNGIE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |