C18H20N4O4S — CID 55520060
6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 55520060) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is 6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 55520060 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(S(=O)(=O)N3CCN(Cc4ccccn4)CC3)cc2N1 |
| InChI | InChI=1S/C18H20N4O4S/c23-18-13-26-17-5-4-15(11-16(17)20-18)27(24,25)22-9-7-21(8-10-22)12-14-3-1-2-6-19-14/h1-6,11H,7-10,12-13H2,(H,20,23) |
| InChIKey | MXFVAAVZRCXPDX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |