C18H21N3O5S — CID 46962934
N-(3-methoxypropyl)-3-oxo-N-(pyridin-2-ylmethyl)-4H-1,4-benzoxazine-6-sulfonamide (PubChem CID 46962934) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-(3-methoxypropyl)-3-oxo-N-(pyridin-2-ylmethyl)-4H-1,4-benzoxazine-6-sulfonamide.
| Compound Name | N-(3-methoxypropyl)-3-oxo-N-(pyridin-2-ylmethyl)-4H-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 46962934 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-(3-methoxypropyl)-3-oxo-N-(pyridin-2-ylmethyl)-4H-1,4-benzoxazine-6-sulfonamide |
| SMILES | COCCCN(Cc1ccccn1)S(=O)(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C18H21N3O5S/c1-25-10-4-9-21(12-14-5-2-3-8-19-14)27(23,24)15-6-7-17-16(11-15)20-18(22)13-26-17/h2-3,5-8,11H,4,9-10,12-13H2,1H3,(H,20,22) |
| InChIKey | VMEGJAMDCVVYBU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|