C18H23ClN2O3S — CID 4209599
4-(2-chloroethyl)-N-(3-methoxypropyl)-N-(pyridin-2-ylmethyl)benzenesulfonamide (PubChem CID 4209599) has the molecular formula C18H23ClN2O3S and a molecular weight of 382.91 g/mol. Its IUPAC name is 4-(2-chloroethyl)-N-(3-methoxypropyl)-N-(pyridin-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(2-chloroethyl)-N-(3-methoxypropyl)-N-(pyridin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4209599 |
| Molecular Formula | C18H23ClN2O3S |
| Molecular Weight | 382.91 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-(2-chloroethyl)-N-(3-methoxypropyl)-N-(pyridin-2-ylmethyl)benzenesulfonamide |
| SMILES | COCCCN(Cc1ccccn1)S(=O)(=O)c1ccc(CCCl)cc1 |
| InChI | InChI=1S/C18H23ClN2O3S/c1-24-14-4-13-21(15-17-5-2-3-12-20-17)25(22,23)18-8-6-16(7-9-18)10-11-19/h2-3,5-9,12H,4,10-11,13-15H2,1H3 |
| InChIKey | CMLQGMPZMVEDPI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|