C24H28N2O2S — CID 121084565
4-tert-butyl-N-(2-phenylethyl)-N-(pyridin-2-ylmethyl)benzenesulfonamide (PubChem CID 121084565) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is 4-tert-butyl-N-(2-phenylethyl)-N-(pyridin-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-(2-phenylethyl)-N-(pyridin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 121084565 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-tert-butyl-N-(2-phenylethyl)-N-(pyridin-2-ylmethyl)benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N(CCc2ccccc2)Cc2ccccn2)cc1 |
| InChI | InChI=1S/C24H28N2O2S/c1-24(2,3)21-12-14-23(15-13-21)29(27,28)26(19-22-11-7-8-17-25-22)18-16-20-9-5-4-6-10-20/h4-15,17H,16,18-19H2,1-3H3 |
| InChIKey | RXAVATRDDGSVGM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |