C28H28N2O4S — CID 42701827
N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-N-(2-pyridin-2-ylethyl)benzenesulfonamide (PubChem CID 42701827) has the molecular formula C28H28N2O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-N-(2-pyridin-2-ylethyl)benzenesulfonamide.
| Compound Name | N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-N-(2-pyridin-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 42701827 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-N-(2-pyridin-2-ylethyl)benzenesulfonamide |
| SMILES | COc1ccc(CN(CCc2ccccn2)S(=O)(=O)c2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C28H28N2O4S/c1-33-27-16-15-24(20-28(27)34-22-23-10-4-2-5-11-23)21-30(19-17-25-12-8-9-18-29-25)35(31,32)26-13-6-3-7-14-26/h2-16,18,20H,17,19,21-22H2,1H3 |
| InChIKey | JXTNAXIIZUOLMU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |