C26H31NO4S — CID 42704317
N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-methyl-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 42704317) has the molecular formula C26H31NO4S and a molecular weight of 453.60 g/mol. Its IUPAC name is N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-methyl-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-methyl-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 42704317 |
| Molecular Formula | C26H31NO4S |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-methyl-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | COc1cc(CN(CC(C)C)S(=O)(=O)c2ccc(C)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H31NO4S/c1-20(2)17-27(32(28,29)24-13-10-21(3)11-14-24)18-23-12-15-25(26(16-23)30-4)31-19-22-8-6-5-7-9-22/h5-16,20H,17-19H2,1-4H3 |
| InChIKey | BPYMMCWTJLIERC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |