C21H29NO7S — CID 10983024
N-(2,2-dimethoxyethyl)-4-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzenesulfonamide (PubChem CID 10983024) has the molecular formula C21H29NO7S and a molecular weight of 439.53 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-4-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | N-(2,2-dimethoxyethyl)-4-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10983024 |
| Molecular Formula | C21H29NO7S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-4-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1cc(CN(CC(OC)OC)S(=O)(=O)c2ccc(C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H29NO7S/c1-15-7-9-17(10-8-15)30(23,24)22(14-20(27-4)28-5)13-16-11-18(25-2)21(29-6)19(12-16)26-3/h7-12,20H,13-14H2,1-6H3 |
| InChIKey | LHFIPOQEWIBEIN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|