C19H24ClNO4S — CID 122457492
N-[(2-chloro-4-methylphenyl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide (PubChem CID 122457492) has the molecular formula C19H24ClNO4S and a molecular weight of 397.92 g/mol. Its IUPAC name is N-[(2-chloro-4-methylphenyl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide.
| Compound Name | N-[(2-chloro-4-methylphenyl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 122457492 |
| Molecular Formula | C19H24ClNO4S |
| Molecular Weight | 397.92 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-[(2-chloro-4-methylphenyl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide |
| SMILES | COC(CN(Cc1ccc(C)cc1Cl)S(=O)(=O)c1ccc(C)cc1)OC |
| InChI | InChI=1S/C19H24ClNO4S/c1-14-6-9-17(10-7-14)26(22,23)21(13-19(24-3)25-4)12-16-8-5-15(2)11-18(16)20/h5-11,19H,12-13H2,1-4H3 |
| InChIKey | DBCWEMQACXCGSI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.92 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|