C27H26Cl2F2N2O4S — CID 159550981
8-chloro-6-fluoroisoquinoline;N-[(2-chloro-4-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide (PubChem CID 159550981) has the molecular formula C27H26Cl2F2N2O4S and a molecular weight of 583.48 g/mol. Its IUPAC name is 8-chloro-6-fluoroisoquinoline;N-[(2-chloro-4-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide.
| Compound Name | 8-chloro-6-fluoroisoquinoline;N-[(2-chloro-4-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 159550981 |
| Molecular Formula | C27H26Cl2F2N2O4S |
| Molecular Weight | 583.48 g/mol |
| Exact Mass | 582.10 |
| IUPAC Name | 8-chloro-6-fluoroisoquinoline;N-[(2-chloro-4-fluorophenyl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide |
| SMILES | COC(CN(Cc1ccc(F)cc1Cl)S(=O)(=O)c1ccc(C)cc1)OC.Fc1cc(Cl)c2cnccc2c1 |
| InChI | InChI=1S/C18H21ClFNO4S.C9H5ClFN/c1-13-4-8-16(9-5-13)26(22,23)21(12-18(24-2)25-3)11-14-6-7-15(20)10-17(14)19;10-9-4-7(11)3-6-1-2-12-5-8(6)9/h4-10,18H,11-12H2,1-3H3;1-5H |
| InChIKey | MFJQISWRKLKGFM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.48 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|