C15H8ClF6NO4S — CID 156851949
2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetic acid (PubChem CID 156851949) has the molecular formula C15H8ClF6NO4S and a molecular weight of 447.74 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 156851949 |
| Molecular Formula | C15H8ClF6NO4S |
| Molecular Weight | 447.74 g/mol |
| Exact Mass | 446.98 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccc(F)cc1Cl)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H8ClF6NO4S/c16-8-3-7(17)2-1-6(8)4-23(5-9(24)25)28(26,27)15-13(21)11(19)10(18)12(20)14(15)22/h1-3H,4-5H2,(H,24,25) |
| InChIKey | SGBJGQMTTRVIIS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|