C36H31ClF6N2O5S — CID 166728138
2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-[(3,5-dicyclopropylphenyl)methyl]-N-[4-(dihydroxymethyl)-2-methylphenyl]acetamide (PubChem CID 166728138) has the molecular formula C36H31ClF6N2O5S and a molecular weight of 753.16 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-[(3,5-dicyclopropylphenyl)methyl]-N-[4-(dihydroxymethyl)-2-methylphenyl]acetamide.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-[(3,5-dicyclopropylphenyl)methyl]-N-[4-(dihydroxymethyl)-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 166728138 |
| Molecular Formula | C36H31ClF6N2O5S |
| Molecular Weight | 753.16 g/mol |
| Exact Mass | 752.15 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-[(3,5-dicyclopropylphenyl)methyl]-N-[4-(dihydroxymethyl)-2-methylphenyl]acetamide |
| SMILES | Cc1cc(C(O)O)ccc1N(Cc1cc(C2CC2)cc(C2CC2)c1)C(=O)CN(Cc1ccc(F)cc1Cl)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C36H31ClF6N2O5S/c1-18-10-22(36(47)48)7-9-28(18)45(15-19-11-24(20-2-3-20)13-25(12-19)21-4-5-21)29(46)17-44(16-23-6-8-26(38)14-27(23)37)51(49,50)35-33(42)31(40)30(39)32(41)34(35)43/h6-14,20-21,36,47-48H,2-5,15-17H2,1H3 |
| InChIKey | QKUBTKSMLDLAMU-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.16 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|