C37H31ClF6N2O6S — CID 156851640
4-[[2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid (PubChem CID 156851640) has the molecular formula C37H31ClF6N2O6S and a molecular weight of 781.17 g/mol. Its IUPAC name is 4-[[2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid.
| Compound Name | 4-[[2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid |
|---|---|
| PubChem CID | 156851640 |
| Molecular Formula | C37H31ClF6N2O6S |
| Molecular Weight | 781.17 g/mol |
| Exact Mass | 780.15 |
| IUPAC Name | 4-[[2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid |
| SMILES | CCOc1cc(C(=O)O)ccc1N(Cc1cc(C2CC2)cc(C2CC2)c1)C(=O)CN(Cc1ccc(F)cc1Cl)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C37H31ClF6N2O6S/c1-2-52-29-14-22(37(48)49)8-10-28(29)46(16-19-11-24(20-3-4-20)13-25(12-19)21-5-6-21)30(47)18-45(17-23-7-9-26(39)15-27(23)38)53(50,51)36-34(43)32(41)31(40)33(42)35(36)44/h7-15,20-21H,2-6,16-18H2,1H3,(H,48,49) |
| InChIKey | CQMGSAVMNBEMKI-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.17 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|