C38H32BrF4N3O6S — CID 162751740
4-[[2-[(2-bromo-3,4,5,6-tetrafluorophenyl)sulfonyl-[(2-cyanophenyl)methyl]amino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid (PubChem CID 162751740) has the molecular formula C38H32BrF4N3O6S and a molecular weight of 814.65 g/mol. Its IUPAC name is 4-[[2-[(2-bromo-3,4,5,6-tetrafluorophenyl)sulfonyl-[(2-cyanophenyl)methyl]amino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid.
| Compound Name | 4-[[2-[(2-bromo-3,4,5,6-tetrafluorophenyl)sulfonyl-[(2-cyanophenyl)methyl]amino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid |
|---|---|
| PubChem CID | 162751740 |
| Molecular Formula | C38H32BrF4N3O6S |
| Molecular Weight | 814.65 g/mol |
| Exact Mass | 813.11 |
| IUPAC Name | 4-[[2-[(2-bromo-3,4,5,6-tetrafluorophenyl)sulfonyl-[(2-cyanophenyl)methyl]amino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid |
| SMILES | CCOc1cc(C(=O)O)ccc1N(Cc1cc(C2CC2)cc(C2CC2)c1)C(=O)CN(Cc1ccccc1C#N)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1Br |
| InChI | InChI=1S/C38H32BrF4N3O6S/c1-2-52-30-16-24(38(48)49)11-12-29(30)46(18-21-13-27(22-7-8-22)15-28(14-21)23-9-10-23)31(47)20-45(19-26-6-4-3-5-25(26)17-44)53(50,51)37-32(39)33(40)34(41)35(42)36(37)43/h3-6,11-16,22-23H,2,7-10,18-20H2,1H3,(H,48,49) |
| InChIKey | VBLBDOHRTKZJLA-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 128.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.65 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|