C36H32F4N4O6S — CID 162751881
4-[[2-[(2-cyanophenyl)methyl-(2,3,4,5-tetrafluorophenyl)sulfonylamino]acetyl]-[(3-pyrrolidin-1-ylphenyl)methyl]amino]-3-ethoxybenzoic acid (PubChem CID 162751881) has the molecular formula C36H32F4N4O6S and a molecular weight of 724.73 g/mol. Its IUPAC name is 4-[[2-[(2-cyanophenyl)methyl-(2,3,4,5-tetrafluorophenyl)sulfonylamino]acetyl]-[(3-pyrrolidin-1-ylphenyl)methyl]amino]-3-ethoxybenzoic acid.
| Compound Name | 4-[[2-[(2-cyanophenyl)methyl-(2,3,4,5-tetrafluorophenyl)sulfonylamino]acetyl]-[(3-pyrrolidin-1-ylphenyl)methyl]amino]-3-ethoxybenzoic acid |
|---|---|
| PubChem CID | 162751881 |
| Molecular Formula | C36H32F4N4O6S |
| Molecular Weight | 724.73 g/mol |
| Exact Mass | 724.20 |
| IUPAC Name | 4-[[2-[(2-cyanophenyl)methyl-(2,3,4,5-tetrafluorophenyl)sulfonylamino]acetyl]-[(3-pyrrolidin-1-ylphenyl)methyl]amino]-3-ethoxybenzoic acid |
| SMILES | CCOc1cc(C(=O)O)ccc1N(Cc1cccc(N2CCCC2)c1)C(=O)CN(Cc1ccccc1C#N)S(=O)(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C36H32F4N4O6S/c1-2-50-30-17-24(36(46)47)12-13-29(30)44(20-23-8-7-11-27(16-23)42-14-5-6-15-42)32(45)22-43(21-26-10-4-3-9-25(26)19-41)51(48,49)31-18-28(37)33(38)35(40)34(31)39/h3-4,7-13,16-18H,2,5-6,14-15,20-22H2,1H3,(H,46,47) |
| InChIKey | VSCFDSOTBARUPR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.73 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|