C39H36F6N2O5S — CID 156851875
4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-cyclopropylbenzoic acid (PubChem CID 156851875) has the molecular formula C39H36F6N2O5S and a molecular weight of 758.78 g/mol. Its IUPAC name is 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-cyclopropylbenzoic acid.
| Compound Name | 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-cyclopropylbenzoic acid |
|---|---|
| PubChem CID | 156851875 |
| Molecular Formula | C39H36F6N2O5S |
| Molecular Weight | 758.78 g/mol |
| Exact Mass | 758.22 |
| IUPAC Name | 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-cyclopropylbenzoic acid |
| SMILES | CC(C)(C)c1cc(CN(C(=O)CN(Cc2ccccc2F)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c2ccc(C(=O)O)cc2C2CC2)cc(C2CC2)c1 |
| InChI | InChI=1S/C39H36F6N2O5S/c1-39(2,3)27-15-21(14-26(16-27)22-8-9-22)18-47(30-13-12-24(38(49)50)17-28(30)23-10-11-23)31(48)20-46(19-25-6-4-5-7-29(25)40)53(51,52)37-35(44)33(42)32(41)34(43)36(37)45/h4-7,12-17,22-23H,8-11,18-20H2,1-3H3,(H,49,50) |
| InChIKey | CTYCETZIPOQORH-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.78 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|