C38H36BrClF4N2O6S — CID 162751764
4-[[2-[(2-bromo-3,4,5,6-tetrafluorophenyl)sulfonyl-[(2-chlorophenyl)methyl]amino]acetyl]-[(3-tert-butyl-5-cyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid (PubChem CID 162751764) has the molecular formula C38H36BrClF4N2O6S and a molecular weight of 840.13 g/mol. Its IUPAC name is 4-[[2-[(2-bromo-3,4,5,6-tetrafluorophenyl)sulfonyl-[(2-chlorophenyl)methyl]amino]acetyl]-[(3-tert-butyl-5-cyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid.
| Compound Name | 4-[[2-[(2-bromo-3,4,5,6-tetrafluorophenyl)sulfonyl-[(2-chlorophenyl)methyl]amino]acetyl]-[(3-tert-butyl-5-cyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid |
|---|---|
| PubChem CID | 162751764 |
| Molecular Formula | C38H36BrClF4N2O6S |
| Molecular Weight | 840.13 g/mol |
| Exact Mass | 838.11 |
| IUPAC Name | 4-[[2-[(2-bromo-3,4,5,6-tetrafluorophenyl)sulfonyl-[(2-chlorophenyl)methyl]amino]acetyl]-[(3-tert-butyl-5-cyclopropylphenyl)methyl]amino]-3-ethoxybenzoic acid |
| SMILES | CCOc1cc(C(=O)O)ccc1N(Cc1cc(C2CC2)cc(C(C)(C)C)c1)C(=O)CN(Cc1ccccc1Cl)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1Br |
| InChI | InChI=1S/C38H36BrClF4N2O6S/c1-5-52-29-17-23(37(48)49)12-13-28(29)46(18-21-14-25(22-10-11-22)16-26(15-21)38(2,3)4)30(47)20-45(19-24-8-6-7-9-27(24)40)53(50,51)36-31(39)32(41)33(42)34(43)35(36)44/h6-9,12-17,22H,5,10-11,18-20H2,1-4H3,(H,48,49) |
| InChIKey | XQGSWHFTHFWPJC-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.13 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|