C38H32Cl2F4N2O6S — CID 162751826
4-[[2-[(2-chlorophenyl)methyl-(2-chloro-3,4,5,6-tetrafluorophenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-cyclopropyloxybenzoic acid (PubChem CID 162751826) has the molecular formula C38H32Cl2F4N2O6S and a molecular weight of 791.65 g/mol. Its IUPAC name is 4-[[2-[(2-chlorophenyl)methyl-(2-chloro-3,4,5,6-tetrafluorophenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-cyclopropyloxybenzoic acid.
| Compound Name | 4-[[2-[(2-chlorophenyl)methyl-(2-chloro-3,4,5,6-tetrafluorophenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-cyclopropyloxybenzoic acid |
|---|---|
| PubChem CID | 162751826 |
| Molecular Formula | C38H32Cl2F4N2O6S |
| Molecular Weight | 791.65 g/mol |
| Exact Mass | 790.13 |
| IUPAC Name | 4-[[2-[(2-chlorophenyl)methyl-(2-chloro-3,4,5,6-tetrafluorophenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-cyclopropyloxybenzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2cc(C3CC3)cc(C3CC3)c2)C(=O)CN(Cc2ccccc2Cl)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2Cl)c(OC2CC2)c1 |
| InChI | InChI=1S/C38H32Cl2F4N2O6S/c39-28-4-2-1-3-24(28)18-45(53(50,51)37-32(40)33(41)34(42)35(43)36(37)44)19-31(47)46(29-12-9-23(38(48)49)16-30(29)52-27-10-11-27)17-20-13-25(21-5-6-21)15-26(14-20)22-7-8-22/h1-4,9,12-16,21-22,27H,5-8,10-11,17-19H2,(H,48,49) |
| InChIKey | DEYNHWMJNHYHGZ-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.65 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|