C38H33ClF6N2O7S — CID 156851781
4-[[2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-(2-methoxyethoxy)benzoic acid (PubChem CID 156851781) has the molecular formula C38H33ClF6N2O7S and a molecular weight of 811.20 g/mol. Its IUPAC name is 4-[[2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-(2-methoxyethoxy)benzoic acid.
| Compound Name | 4-[[2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-(2-methoxyethoxy)benzoic acid |
|---|---|
| PubChem CID | 156851781 |
| Molecular Formula | C38H33ClF6N2O7S |
| Molecular Weight | 811.20 g/mol |
| Exact Mass | 810.16 |
| IUPAC Name | 4-[[2-[(2-chloro-4-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-[(3,5-dicyclopropylphenyl)methyl]amino]-3-(2-methoxyethoxy)benzoic acid |
| SMILES | COCCOc1cc(C(=O)O)ccc1N(Cc1cc(C2CC2)cc(C2CC2)c1)C(=O)CN(Cc1ccc(F)cc1Cl)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C38H33ClF6N2O7S/c1-53-10-11-54-30-15-23(38(49)50)7-9-29(30)47(17-20-12-25(21-2-3-21)14-26(13-20)22-4-5-22)31(48)19-46(18-24-6-8-27(40)16-28(24)39)55(51,52)37-35(44)33(42)32(41)34(43)36(37)45/h6-9,12-16,21-22H,2-5,10-11,17-19H2,1H3,(H,49,50) |
| InChIKey | FSMRPPLPSQZGHL-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.20 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|