C36H28F8N2O5S — CID 168753086
4-[(3,5-dicyclopropylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfonyl-[(2,4,6-trifluorophenyl)methyl]amino]acetyl]amino]-3-methylbenzoic acid (PubChem CID 168753086) has the molecular formula C36H28F8N2O5S and a molecular weight of 752.68 g/mol. Its IUPAC name is 4-[(3,5-dicyclopropylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfonyl-[(2,4,6-trifluorophenyl)methyl]amino]acetyl]amino]-3-methylbenzoic acid.
| Compound Name | 4-[(3,5-dicyclopropylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfonyl-[(2,4,6-trifluorophenyl)methyl]amino]acetyl]amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 168753086 |
| Molecular Formula | C36H28F8N2O5S |
| Molecular Weight | 752.68 g/mol |
| Exact Mass | 752.16 |
| IUPAC Name | 4-[(3,5-dicyclopropylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfonyl-[(2,4,6-trifluorophenyl)methyl]amino]acetyl]amino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1N(Cc1cc(C2CC2)cc(C2CC2)c1)C(=O)CN(Cc1c(F)cc(F)cc1F)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C36H28F8N2O5S/c1-17-8-21(36(48)49)6-7-28(17)46(14-18-9-22(19-2-3-19)11-23(10-18)20-4-5-20)29(47)16-45(15-25-26(38)12-24(37)13-27(25)39)52(50,51)35-33(43)31(41)30(40)32(42)34(35)44/h6-13,19-20H,2-5,14-16H2,1H3,(H,48,49) |
| InChIKey | CIHCVYNOBJCHTA-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.68 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|