C39H38BrF4N3O6S — CID 162751816
4-[[2-[(2-bromo-3,4,5,6-tetrafluorophenyl)sulfonyl-[(2-methylphenyl)methyl]amino]acetyl]-[(3-cyclopropyl-5-pyrrolidin-1-ylphenyl)methyl]amino]-3-ethoxybenzoic acid (PubChem CID 162751816) has the molecular formula C39H38BrF4N3O6S and a molecular weight of 832.71 g/mol. Its IUPAC name is 4-[[2-[(2-bromo-3,4,5,6-tetrafluorophenyl)sulfonyl-[(2-methylphenyl)methyl]amino]acetyl]-[(3-cyclopropyl-5-pyrrolidin-1-ylphenyl)methyl]amino]-3-ethoxybenzoic acid.
| Compound Name | 4-[[2-[(2-bromo-3,4,5,6-tetrafluorophenyl)sulfonyl-[(2-methylphenyl)methyl]amino]acetyl]-[(3-cyclopropyl-5-pyrrolidin-1-ylphenyl)methyl]amino]-3-ethoxybenzoic acid |
|---|---|
| PubChem CID | 162751816 |
| Molecular Formula | C39H38BrF4N3O6S |
| Molecular Weight | 832.71 g/mol |
| Exact Mass | 831.16 |
| IUPAC Name | 4-[[2-[(2-bromo-3,4,5,6-tetrafluorophenyl)sulfonyl-[(2-methylphenyl)methyl]amino]acetyl]-[(3-cyclopropyl-5-pyrrolidin-1-ylphenyl)methyl]amino]-3-ethoxybenzoic acid |
| SMILES | CCOc1cc(C(=O)O)ccc1N(Cc1cc(C2CC2)cc(N2CCCC2)c1)C(=O)CN(Cc1ccccc1C)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1Br |
| InChI | InChI=1S/C39H38BrF4N3O6S/c1-3-53-31-19-26(39(49)50)12-13-30(31)47(20-24-16-28(25-10-11-25)18-29(17-24)45-14-6-7-15-45)32(48)22-46(21-27-9-5-4-8-23(27)2)54(51,52)38-33(40)34(41)35(42)36(43)37(38)44/h4-5,8-9,12-13,16-19,25H,3,6-7,10-11,14-15,20-22H2,1-2H3,(H,49,50) |
| InChIKey | FNQIRMNWOYNREG-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.71 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|