C37H34F6N2O5S — CID 156851826
4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-methylbenzoic acid (PubChem CID 156851826) has the molecular formula C37H34F6N2O5S and a molecular weight of 732.74 g/mol. Its IUPAC name is 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-methylbenzoic acid.
| Compound Name | 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 156851826 |
| Molecular Formula | C37H34F6N2O5S |
| Molecular Weight | 732.74 g/mol |
| Exact Mass | 732.21 |
| IUPAC Name | 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1N(Cc1cc(C2CC2)cc(C(C)(C)C)c1)C(=O)CN(Cc1ccccc1F)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C37H34F6N2O5S/c1-20-13-23(36(47)48)11-12-28(20)45(17-21-14-25(22-9-10-22)16-26(15-21)37(2,3)4)29(46)19-44(18-24-7-5-6-8-27(24)38)51(49,50)35-33(42)31(40)30(39)32(41)34(35)43/h5-8,11-16,22H,9-10,17-19H2,1-4H3,(H,47,48) |
| InChIKey | JDLHIUNJSSDEJR-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.74 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|