C35H33BF6N2O5S — CID 156851753
[4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]phenyl]boronic acid (PubChem CID 156851753) has the molecular formula C35H33BF6N2O5S and a molecular weight of 718.53 g/mol. Its IUPAC name is [4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]phenyl]boronic acid.
| Compound Name | [4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]phenyl]boronic acid |
|---|---|
| PubChem CID | 156851753 |
| Molecular Formula | C35H33BF6N2O5S |
| Molecular Weight | 718.53 g/mol |
| Exact Mass | 718.21 |
| IUPAC Name | [4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]phenyl]boronic acid |
| SMILES | CC(C)(C)c1cc(CN(C(=O)CN(Cc2ccccc2F)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c2ccc(B(O)O)cc2)cc(C2CC2)c1 |
| InChI | InChI=1S/C35H33BF6N2O5S/c1-35(2,3)24-15-20(14-23(16-24)21-8-9-21)17-44(26-12-10-25(11-13-26)36(46)47)28(45)19-43(18-22-6-4-5-7-27(22)37)50(48,49)34-32(41)30(39)29(38)31(40)33(34)42/h4-7,10-16,21,46-47H,8-9,17-19H2,1-3H3 |
| InChIKey | REVVWTBCRPUYBE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|