C36H37F6N3O6S — CID 166728175
N-[(2,6-ditert-butyl-4-pyridinyl)methyl]-N-[4-(dihydroxymethyl)-3-hydroxyphenyl]-2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetamide (PubChem CID 166728175) has the molecular formula C36H37F6N3O6S and a molecular weight of 753.76 g/mol. Its IUPAC name is N-[(2,6-ditert-butyl-4-pyridinyl)methyl]-N-[4-(dihydroxymethyl)-3-hydroxyphenyl]-2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetamide.
| Compound Name | N-[(2,6-ditert-butyl-4-pyridinyl)methyl]-N-[4-(dihydroxymethyl)-3-hydroxyphenyl]-2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 166728175 |
| Molecular Formula | C36H37F6N3O6S |
| Molecular Weight | 753.76 g/mol |
| Exact Mass | 753.23 |
| IUPAC Name | N-[(2,6-ditert-butyl-4-pyridinyl)methyl]-N-[4-(dihydroxymethyl)-3-hydroxyphenyl]-2-[(2-fluorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetamide |
| SMILES | CC(C)(C)c1cc(CN(C(=O)CN(Cc2ccccc2F)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c2ccc(C(O)O)c(O)c2)cc(C(C)(C)C)n1 |
| InChI | InChI=1S/C36H37F6N3O6S/c1-35(2,3)25-13-19(14-26(43-25)36(4,5)6)16-45(21-11-12-22(34(48)49)24(46)15-21)27(47)18-44(17-20-9-7-8-10-23(20)37)52(50,51)33-31(41)29(39)28(38)30(40)32(33)42/h7-15,34,46,48-49H,16-18H2,1-6H3 |
| InChIKey | GLJJUWRGFBFCIQ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.76 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|