C36H30F8N2O7S — CID 73334151
4-[(4-cyclohexylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfonyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]acetyl]amino]-2-hydroxybenzoic acid (PubChem CID 73334151) has the molecular formula C36H30F8N2O7S and a molecular weight of 786.69 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfonyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]acetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(4-cyclohexylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfonyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]acetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 73334151 |
| Molecular Formula | C36H30F8N2O7S |
| Molecular Weight | 786.69 g/mol |
| Exact Mass | 786.16 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfonyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]acetyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc(C3CCCCC3)cc2)C(=O)CN(Cc2ccccc2OC(F)(F)F)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C36H30F8N2O7S/c37-29-30(38)32(40)34(33(41)31(29)39)54(51,52)45(18-23-8-4-5-9-27(23)53-36(42,43)44)19-28(48)46(24-14-15-25(35(49)50)26(47)16-24)17-20-10-12-22(13-11-20)21-6-2-1-3-7-21/h4-5,8-16,21,47H,1-3,6-7,17-19H2,(H,49,50) |
| InChIKey | CUUFNRPHBWJLJO-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.69 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|