C35H27F9N2O6S — CID 73334352
4-[(4-cyclohexylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfonyl-[(2,3,5,6-tetrafluorophenyl)methyl]amino]acetyl]amino]-2-hydroxybenzoic acid (PubChem CID 73334352) has the molecular formula C35H27F9N2O6S and a molecular weight of 774.66 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfonyl-[(2,3,5,6-tetrafluorophenyl)methyl]amino]acetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(4-cyclohexylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfonyl-[(2,3,5,6-tetrafluorophenyl)methyl]amino]acetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 73334352 |
| Molecular Formula | C35H27F9N2O6S |
| Molecular Weight | 774.66 g/mol |
| Exact Mass | 774.14 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)methyl-[2-[(2,3,4,5,6-pentafluorophenyl)sulfonyl-[(2,3,5,6-tetrafluorophenyl)methyl]amino]acetyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc(C3CCCCC3)cc2)C(=O)CN(Cc2c(F)c(F)cc(F)c2F)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C35H27F9N2O6S/c36-23-13-24(37)28(39)22(27(23)38)15-45(53(51,52)34-32(43)30(41)29(40)31(42)33(34)44)16-26(48)46(20-10-11-21(35(49)50)25(47)12-20)14-17-6-8-19(9-7-17)18-4-2-1-3-5-18/h6-13,18,47H,1-5,14-16H2,(H,49,50) |
| InChIKey | DAHGYKQHKQKZGE-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.66 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|