C33H22ClF5N2O6S — CID 118554144
4-[[2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-(naphthalen-2-ylmethyl)amino]-2-hydroxybenzoic acid (PubChem CID 118554144) has the molecular formula C33H22ClF5N2O6S and a molecular weight of 705.06 g/mol. Its IUPAC name is 4-[[2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-(naphthalen-2-ylmethyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-(naphthalen-2-ylmethyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 118554144 |
| Molecular Formula | C33H22ClF5N2O6S |
| Molecular Weight | 705.06 g/mol |
| Exact Mass | 704.08 |
| IUPAC Name | 4-[[2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]-(naphthalen-2-ylmethyl)amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2ccc3ccccc3c2)C(=O)CN(Cc2ccc(Cl)cc2)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1O |
| InChI | InChI=1S/C33H22ClF5N2O6S/c34-22-9-6-18(7-10-22)15-40(48(46,47)32-30(38)28(36)27(35)29(37)31(32)39)17-26(43)41(23-11-12-24(33(44)45)25(42)14-23)16-19-5-8-20-3-1-2-4-21(20)13-19/h1-14,42H,15-17H2,(H,44,45) |
| InChIKey | BCEHWKNPQWMRLQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.06 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|