C31H18ClF11N2O5S — CID 162565128
4-[[3,5-bis(trifluoromethyl)phenyl]methyl-[2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid (PubChem CID 162565128) has the molecular formula C31H18ClF11N2O5S and a molecular weight of 774.99 g/mol. Its IUPAC name is 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-[2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid.
| Compound Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-[2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 162565128 |
| Molecular Formula | C31H18ClF11N2O5S |
| Molecular Weight | 774.99 g/mol |
| Exact Mass | 774.04 |
| IUPAC Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methyl-[2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)CN(Cc2ccc(Cl)cc2)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C31H18ClF11N2O5S/c32-20-5-1-15(2-6-20)12-44(51(49,50)28-26(36)24(34)23(33)25(35)27(28)37)14-22(46)45(21-7-3-17(4-8-21)29(47)48)13-16-9-18(30(38,39)40)11-19(10-16)31(41,42)43/h1-11H,12-14H2,(H,47,48) |
| InChIKey | PYIOODQDZHXSNS-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.99 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|