C29H20BrCl2F5N2O6S — CID 166728213
N-[(3-bromo-5-chlorophenyl)methyl]-2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-[4-(dihydroxymethyl)-3-hydroxyphenyl]acetamide (PubChem CID 166728213) has the molecular formula C29H20BrCl2F5N2O6S and a molecular weight of 770.35 g/mol. Its IUPAC name is N-[(3-bromo-5-chlorophenyl)methyl]-2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-[4-(dihydroxymethyl)-3-hydroxyphenyl]acetamide.
| Compound Name | N-[(3-bromo-5-chlorophenyl)methyl]-2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-[4-(dihydroxymethyl)-3-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 166728213 |
| Molecular Formula | C29H20BrCl2F5N2O6S |
| Molecular Weight | 770.35 g/mol |
| Exact Mass | 767.95 |
| IUPAC Name | N-[(3-bromo-5-chlorophenyl)methyl]-2-[(4-chlorophenyl)methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-[4-(dihydroxymethyl)-3-hydroxyphenyl]acetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)cc1)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)N(Cc1cc(Cl)cc(Br)c1)c1ccc(C(O)O)c(O)c1 |
| InChI | InChI=1S/C29H20BrCl2F5N2O6S/c30-16-7-15(8-18(32)9-16)12-39(19-5-6-20(29(42)43)21(40)10-19)22(41)13-38(11-14-1-3-17(31)4-2-14)46(44,45)28-26(36)24(34)23(33)25(35)27(28)37/h1-10,29,40,42-43H,11-13H2 |
| InChIKey | JJSVYMJRJITKTO-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.35 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|